C20H29NO — CID 123971279
3-methanimidoyl-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 123971279) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is 3-methanimidoyl-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 3-methanimidoyl-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123971279 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 3-methanimidoyl-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | [H]/N=C/C1=CC2CCC3C4CCC(=O)C4(C)CCC3C2(C)CC1 |
| InChI | InChI=1S/C20H29NO/c1-19-9-7-13(12-21)11-14(19)3-4-15-16-5-6-18(22)20(16,2)10-8-17(15)19/h11-12,14-17,21H,3-10H2,1-2H3/b21-12+ |
| InChIKey | BYTZJZRGQGTOAF-CIAFOILYSA-N |
| XLogP | 4.78 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|