C20H16ClN3O2 — CID 123971962
4-[5-(3-chlorophenyl)furan-2-yl]-1,4,4a,6,7,8-hexahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 123971962) has the molecular formula C20H16ClN3O2 and a molecular weight of 365.82 g/mol. Its IUPAC name is 4-[5-(3-chlorophenyl)furan-2-yl]-1,4,4a,6,7,8-hexahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | 4-[5-(3-chlorophenyl)furan-2-yl]-1,4,4a,6,7,8-hexahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 123971962 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-[5-(3-chlorophenyl)furan-2-yl]-1,4,4a,6,7,8-hexahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | O=C1CCCC2=Nc3[nH]ncc3C(c3ccc(-c4cccc(Cl)c4)o3)C12 |
| InChI | InChI=1S/C20H16ClN3O2/c21-12-4-1-3-11(9-12)16-7-8-17(26-16)18-13-10-22-24-20(13)23-14-5-2-6-15(25)19(14)18/h1,3-4,7-10,18-19H,2,5-6H2,(H,22,24) |
| InChIKey | COZXOHMHJOOYON-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |