C41H49FNO2+ — CID 123971992
10-(4-butylphenyl)-2,6-diethyl-15-fluoro-4-(4-methoxypent-3-en-2-yloxy)-14-methyl-1-azoniapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-1(13),7(12),8,10,14,16,18,20-octaene (PubChem CID 123971992) has the molecular formula C41H49FNO2+ and a molecular weight of 606.85 g/mol. Its IUPAC name is 10-(4-butylphenyl)-2,6-diethyl-15-fluoro-4-(4-methoxypent-3-en-2-yloxy)-14-methyl-1-azoniapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-1(13),7(12),8,10,14,16,18,20-octaene.
| Compound Name | 10-(4-butylphenyl)-2,6-diethyl-15-fluoro-4-(4-methoxypent-3-en-2-yloxy)-14-methyl-1-azoniapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-1(13),7(12),8,10,14,16,18,20-octaene |
|---|---|
| PubChem CID | 123971992 |
| Molecular Formula | C41H49FNO2+ |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | 10-(4-butylphenyl)-2,6-diethyl-15-fluoro-4-(4-methoxypent-3-en-2-yloxy)-14-methyl-1-azoniapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-1(13),7(12),8,10,14,16,18,20-octaene |
| SMILES | CCCCc1ccc(-c2ccc3c(c2)-c2c(C)c(F)c4ccccc4[n+]2C2(CC)CC(OC(C)C=C(C)OC)CC32CC)cc1 |
| InChI | InChI=1S/C41H49FNO2/c1-8-11-14-30-17-19-31(20-18-30)32-21-22-36-35(24-32)39-29(6)38(42)34-15-12-13-16-37(34)43(39)41(10-3)26-33(25-40(36,41)9-2)45-28(5)23-27(4)44-7/h12-13,15-24,28,33H,8-11,14,25-26H2,1-7H3/q+1 |
| InChIKey | MELPAZVATRMYHH-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|