About 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one
3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one (PubChem CID 123972028) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one.
Molecular Properties
| Compound Name | 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one |
| PubChem CID | 123972028 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one |
| SMILES | C/N=C(\C)C1CC(=O)C/C1=N\C |
| InChI | InChI=1S/C9H14N2O/c1-6(10-2)8-4-7(12)5-9(8)11-3/h8H,4-5H2,1-3H3/b10-6+,11-9+ |
| InChIKey | DKRWHTLXUZYQAS-BBYAVRKXSA-N |
| XLogP | 1.13 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one?
The IUPAC name of 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one (CID 123972028) is 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one.
What is the SMILES notation for 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one?
The canonical SMILES for 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one is C/N=C(\C)C1CC(=O)C/C1=N\C.
What is the InChIKey of 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one?
The InChIKey is DKRWHTLXUZYQAS-BBYAVRKXSA-N. The full InChI is InChI=1S/C9H14N2O/c1-6(10-2)8-4-7(12)5-9(8)11-3/h8H,4-5H2,1-3H3/b10-6+,11-9+.
What are the key properties of 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one?
3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one has a molecular weight of 166.22 g/mol, XLogP of 1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(C,N-dimethylcarbonimidoyl)-4-methyliminocyclopentan-1-one is sourced from PubChem (CID 123972028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).