C19H20ClN5O2 — CID 123972289
[amino-[6-[3-chloro-4-(3-methyl-3,4,5,6-tetrahydro-2H-azepin-2-yl)phenyl]pyrimidin-4-yl]methylidene]carbamic acid (PubChem CID 123972289) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is [amino-[6-[3-chloro-4-(3-methyl-3,4,5,6-tetrahydro-2H-azepin-2-yl)phenyl]pyrimidin-4-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-[3-chloro-4-(3-methyl-3,4,5,6-tetrahydro-2H-azepin-2-yl)phenyl]pyrimidin-4-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123972289 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [amino-[6-[3-chloro-4-(3-methyl-3,4,5,6-tetrahydro-2H-azepin-2-yl)phenyl]pyrimidin-4-yl]methylidene]carbamic acid |
| SMILES | CC1CCCC=NC1c1ccc(-c2cc(C(N)=NC(=O)O)ncn2)cc1Cl |
| InChI | InChI=1S/C19H20ClN5O2/c1-11-4-2-3-7-22-17(11)13-6-5-12(8-14(13)20)15-9-16(24-10-23-15)18(21)25-19(26)27/h5-11,17H,2-4H2,1H3,(H2,21,25)(H,26,27) |
| InChIKey | PHCSEQLABQTRSW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 113.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|