C18H17N3O4S — CID 123972310
5-[[4-[2-(hydroxymethylimino)-2-pyridin-2-ylethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 123972310) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 5-[[4-[2-(hydroxymethylimino)-2-pyridin-2-ylethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(hydroxymethylimino)-2-pyridin-2-ylethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123972310 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 5-[[4-[2-(hydroxymethylimino)-2-pyridin-2-ylethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCC(=NCO)c3ccccn3)cc2)S1 |
| InChI | InChI=1S/C18H17N3O4S/c22-11-20-15(14-3-1-2-8-19-14)10-25-13-6-4-12(5-7-13)9-16-17(23)21-18(24)26-16/h1-8,16,22H,9-11H2,(H,21,23,24) |
| InChIKey | DYRBXUQLYYFTOQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|