C14H15F3N4 — CID 123972546
N'-[1-[(3,4-difluorophenyl)methyl]-5-fluoro-2H-pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 123972546) has the molecular formula C14H15F3N4 and a molecular weight of 296.30 g/mol. Its IUPAC name is N'-[1-[(3,4-difluorophenyl)methyl]-5-fluoro-2H-pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(3,4-difluorophenyl)methyl]-5-fluoro-2H-pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 123972546 |
| Molecular Formula | C14H15F3N4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N'-[1-[(3,4-difluorophenyl)methyl]-5-fluoro-2H-pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/C1=NCN(Cc2ccc(F)c(F)c2)C=C1F |
| InChI | InChI=1S/C14H15F3N4/c1-20(2)8-18-14-13(17)7-21(9-19-14)6-10-3-4-11(15)12(16)5-10/h3-5,7-8H,6,9H2,1-2H3/b18-8+ |
| InChIKey | ZIDPKFSNCLKXQX-QGMBQPNBSA-N |
| XLogP | 2.54 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|