C29H32F3N7O — CID 123972686
2-cyclopropyl-1-[4-[4-[1-[3-[(2,2,2-trifluoroethylamino)methylamino]phenyl]benzimidazol-5-yl]pyrazol-1-yl]piperidin-1-yl]ethanone (PubChem CID 123972686) has the molecular formula C29H32F3N7O and a molecular weight of 551.62 g/mol. Its IUPAC name is 2-cyclopropyl-1-[4-[4-[1-[3-[(2,2,2-trifluoroethylamino)methylamino]phenyl]benzimidazol-5-yl]pyrazol-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-cyclopropyl-1-[4-[4-[1-[3-[(2,2,2-trifluoroethylamino)methylamino]phenyl]benzimidazol-5-yl]pyrazol-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 123972686 |
| Molecular Formula | C29H32F3N7O |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 2-cyclopropyl-1-[4-[4-[1-[3-[(2,2,2-trifluoroethylamino)methylamino]phenyl]benzimidazol-5-yl]pyrazol-1-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(CC1CC1)N1CCC(n2cc(-c3ccc4c(c3)ncn4-c3cccc(NCNCC(F)(F)F)c3)cn2)CC1 |
| InChI | InChI=1S/C29H32F3N7O/c30-29(31,32)17-33-18-34-23-2-1-3-25(14-23)38-19-35-26-13-21(6-7-27(26)38)22-15-36-39(16-22)24-8-10-37(11-9-24)28(40)12-20-4-5-20/h1-3,6-7,13-16,19-20,24,33-34H,4-5,8-12,17-18H2 |
| InChIKey | SKUPWKIBHJBGFF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|