About 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine
5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine (PubChem CID 123973033) has the molecular formula C15H15ClN4S2
and a molecular weight of 350.90 g/mol. Its IUPAC name is 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine |
| PubChem CID | 123973033 |
| Molecular Formula | C15H15ClN4S2 |
| Molecular Weight | 350.90 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine |
| SMILES | CCNc1nc(C)c(-c2csc(Nc3ccccc3Cl)n2)s1 |
| InChI | InChI=1S/C15H15ClN4S2/c1-3-17-14-18-9(2)13(22-14)12-8-21-15(20-12)19-11-7-5-4-6-10(11)16/h4-8H,3H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | LNKPEBJBYWQRHP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.90 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine?
The IUPAC name of 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine (CID 123973033) is 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine is CCNc1nc(C)c(-c2csc(Nc3ccccc3Cl)n2)s1.
What is the InChIKey of 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine?
The InChIKey is LNKPEBJBYWQRHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN4S2/c1-3-17-14-18-9(2)13(22-14)12-8-21-15(20-12)19-11-7-5-4-6-10(11)16/h4-8H,3H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine?
5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine has a molecular weight of 350.90 g/mol, XLogP of 5.40, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-N-ethyl-4-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 123973033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).