About 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane
1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane (PubChem CID 123973487) has the molecular formula C20H25FN2+2
and a molecular weight of 312.43 g/mol. Its IUPAC name is 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane |
| PubChem CID | 123973487 |
| Molecular Formula | C20H25FN2+2 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane |
| SMILES | CC[N+]12CC[N+](F)(CC1)C(c1ccccc1)C2c1ccccc1 |
| InChI | InChI=1S/C20H25FN2/c1-2-22-13-15-23(21,16-14-22)20(18-11-7-4-8-12-18)19(22)17-9-5-3-6-10-17/h3-12,19-20H,2,13-16H2,1H3/q+2 |
| InChIKey | NYPVBUFAJMSPOE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane?
The IUPAC name of 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane (CID 123973487) is 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane.
What is the SMILES notation for 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane?
The canonical SMILES for 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane is CC[N+]12CC[N+](F)(CC1)C(c1ccccc1)C2c1ccccc1.
What is the InChIKey of 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane?
The InChIKey is NYPVBUFAJMSPOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN2/c1-2-22-13-15-23(21,16-14-22)20(18-11-7-4-8-12-18)19(22)17-9-5-3-6-10-17/h3-12,19-20H,2,13-16H2,1H3/q+2.
What are the key properties of 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane?
1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane has a molecular weight of 312.43 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-fluoro-2,3-diphenyl-1,4-diazoniabicyclo[2.2.2]octane is sourced from PubChem (CID 123973487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).