C29H18N2S — CID 123973582
N-(4-isocyanophenyl)-N-phenylnaphtho[2,1-b][1]benzothiol-10-amine (PubChem CID 123973582) has the molecular formula C29H18N2S and a molecular weight of 426.54 g/mol. Its IUPAC name is N-(4-isocyanophenyl)-N-phenylnaphtho[2,1-b][1]benzothiol-10-amine.
| Compound Name | N-(4-isocyanophenyl)-N-phenylnaphtho[2,1-b][1]benzothiol-10-amine |
|---|---|
| PubChem CID | 123973582 |
| Molecular Formula | C29H18N2S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-(4-isocyanophenyl)-N-phenylnaphtho[2,1-b][1]benzothiol-10-amine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccccc2)c2ccc3sc4ccc5ccccc5c4c3c2)cc1 |
| InChI | InChI=1S/C29H18N2S/c1-30-21-12-14-23(15-13-21)31(22-8-3-2-4-9-22)24-16-18-27-26(19-24)29-25-10-6-5-7-20(25)11-17-28(29)32-27/h2-19H |
| InChIKey | AESURCIFFCDDHC-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|