C25H29N7O4 — CID 123973814
2-[5-[1-[[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-pyridinyl]amino]ethyl]-1,3,4-oxadiazol-2-yl]-5,6-dimethoxy-3H-isoindol-1-one (PubChem CID 123973814) has the molecular formula C25H29N7O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-[5-[1-[[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-pyridinyl]amino]ethyl]-1,3,4-oxadiazol-2-yl]-5,6-dimethoxy-3H-isoindol-1-one.
| Compound Name | 2-[5-[1-[[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-pyridinyl]amino]ethyl]-1,3,4-oxadiazol-2-yl]-5,6-dimethoxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 123973814 |
| Molecular Formula | C25H29N7O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 2-[5-[1-[[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-3-pyridinyl]amino]ethyl]-1,3,4-oxadiazol-2-yl]-5,6-dimethoxy-3H-isoindol-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)N(c1nnc(C(C)Nc3cnccc3N3CC4CNCC4C3)o1)C2 |
| InChI | InChI=1S/C25H29N7O4/c1-14(28-19-10-26-5-4-20(19)31-11-16-8-27-9-17(16)12-31)23-29-30-25(36-23)32-13-15-6-21(34-2)22(35-3)7-18(15)24(32)33/h4-7,10,14,16-17,27-28H,8-9,11-13H2,1-3H3 |
| InChIKey | XWCOYTACGCIKBZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |