C19H24ClFN4O2 — CID 123973838
tert-butyl 3-[[(7-chloro-1,6-naphthyridin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate (PubChem CID 123973838) has the molecular formula C19H24ClFN4O2 and a molecular weight of 394.88 g/mol. Its IUPAC name is tert-butyl 3-[[(7-chloro-1,6-naphthyridin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(7-chloro-1,6-naphthyridin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123973838 |
| Molecular Formula | C19H24ClFN4O2 |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | tert-butyl 3-[[(7-chloro-1,6-naphthyridin-5-yl)amino]methyl]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(F)(CNc2nc(Cl)cc3ncccc23)C1 |
| InChI | InChI=1S/C19H24ClFN4O2/c1-18(2,3)27-17(26)25-9-5-7-19(21,12-25)11-23-16-13-6-4-8-22-14(13)10-15(20)24-16/h4,6,8,10H,5,7,9,11-12H2,1-3H3,(H,23,24) |
| InChIKey | IGSHSKPHVYOQJD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|