C23H20F2O4 — CID 123974431
(1S,2R,6S,7R)-4-[4-(2,3-difluorophenoxy)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123974431) has the molecular formula C23H20F2O4 and a molecular weight of 398.41 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[4-(2,3-difluorophenoxy)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4-[4-(2,3-difluorophenoxy)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123974431 |
| Molecular Formula | C23H20F2O4 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (1S,2R,6S,7R)-4-[4-(2,3-difluorophenoxy)-2,6-dimethylphenyl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1cc(Oc2cccc(F)c2F)cc(C)c1C1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C23H20F2O4/c1-10-8-12(28-16-5-3-4-13(24)21(16)25)9-11(2)17(10)20-22(26)18-14-6-7-15(29-14)19(18)23(20)27/h3-5,8-9,14-15,18-20H,6-7H2,1-2H3/t14-,15+,18-,19+,20? |
| InChIKey | OFMWYANCHMOPSI-GCTVEYNFSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|