C20H19F2NO2S — CID 123974507
ethyl 2-(2,5-difluorophenyl)-5-(2-ethylidenehexa-3,5-dienyl)-1,3-thiazole-4-carboxylate (PubChem CID 123974507) has the molecular formula C20H19F2NO2S and a molecular weight of 375.44 g/mol. Its IUPAC name is ethyl 2-(2,5-difluorophenyl)-5-(2-ethylidenehexa-3,5-dienyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(2,5-difluorophenyl)-5-(2-ethylidenehexa-3,5-dienyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 123974507 |
| Molecular Formula | C20H19F2NO2S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl 2-(2,5-difluorophenyl)-5-(2-ethylidenehexa-3,5-dienyl)-1,3-thiazole-4-carboxylate |
| SMILES | C=CC=CC(=CC)Cc1sc(-c2cc(F)ccc2F)nc1C(=O)OCC |
| InChI | InChI=1S/C20H19F2NO2S/c1-4-7-8-13(5-2)11-17-18(20(24)25-6-3)23-19(26-17)15-12-14(21)9-10-16(15)22/h4-5,7-10,12H,1,6,11H2,2-3H3 |
| InChIKey | APZMHVMMERTQLL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|