C33H47ClN4O7 — CID 123974744
(3S)-3-[[(5S,8S)-3-(3-chlorophenyl)-7-[(2S)-2-[(2-cyclohexylacetyl)amino]-3,3-dimethylbutanoyl]-1-oxa-2,7-diazaspiro[4.4]non-3-ene-8-carbonyl]amino]-2-hydroxyhexanoic acid (PubChem CID 123974744) has the molecular formula C33H47ClN4O7 and a molecular weight of 647.21 g/mol. Its IUPAC name is (3S)-3-[[(5S,8S)-3-(3-chlorophenyl)-7-[(2S)-2-[(2-cyclohexylacetyl)amino]-3,3-dimethylbutanoyl]-1-oxa-2,7-diazaspiro[4.4]non-3-ene-8-carbonyl]amino]-2-hydroxyhexanoic acid.
| Compound Name | (3S)-3-[[(5S,8S)-3-(3-chlorophenyl)-7-[(2S)-2-[(2-cyclohexylacetyl)amino]-3,3-dimethylbutanoyl]-1-oxa-2,7-diazaspiro[4.4]non-3-ene-8-carbonyl]amino]-2-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 123974744 |
| Molecular Formula | C33H47ClN4O7 |
| Molecular Weight | 647.21 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | (3S)-3-[[(5S,8S)-3-(3-chlorophenyl)-7-[(2S)-2-[(2-cyclohexylacetyl)amino]-3,3-dimethylbutanoyl]-1-oxa-2,7-diazaspiro[4.4]non-3-ene-8-carbonyl]amino]-2-hydroxyhexanoic acid |
| SMILES | CCC[C@H](NC(=O)[C@@H]1C[C@]2(C=C(c3cccc(Cl)c3)NO2)CN1C(=O)[C@@H](NC(=O)CC1CCCCC1)C(C)(C)C)C(O)C(=O)O |
| InChI | InChI=1S/C33H47ClN4O7/c1-5-10-23(27(40)31(43)44)35-29(41)25-18-33(17-24(37-45-33)21-13-9-14-22(34)16-21)19-38(25)30(42)28(32(2,3)4)36-26(39)15-20-11-7-6-8-12-20/h9,13-14,16-17,20,23,25,27-28,37,40H,5-8,10-12,15,18-19H2,1-4H3,(H,35,41)(H,36,39)(H,43,44)/t23-,25-,27?,28+,33+/m0/s1 |
| InChIKey | STYDLNLPPCCNDW-KEXYIOKOSA-N |
| XLogP | 3.79 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |