C30H24F3N7O2S — CID 123975140
6-[2-(4-aminophenyl)pyrazol-3-yl]-7-methyl-N-(4-methylsulfonylphenyl)-8-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 123975140) has the molecular formula C30H24F3N7O2S and a molecular weight of 603.63 g/mol. Its IUPAC name is 6-[2-(4-aminophenyl)pyrazol-3-yl]-7-methyl-N-(4-methylsulfonylphenyl)-8-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-[2-(4-aminophenyl)pyrazol-3-yl]-7-methyl-N-(4-methylsulfonylphenyl)-8-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 123975140 |
| Molecular Formula | C30H24F3N7O2S |
| Molecular Weight | 603.63 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | 6-[2-(4-aminophenyl)pyrazol-3-yl]-7-methyl-N-(4-methylsulfonylphenyl)-8-[3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1c(-c2ccnn2-c2ccc(N)cc2)cn2nc(Nc3ccc(S(C)(=O)=O)cc3)nc2c1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H24F3N7O2S/c1-18-25(26-14-15-35-40(26)23-10-6-21(34)7-11-23)17-39-28(27(18)19-4-3-5-20(16-19)30(31,32)33)37-29(38-39)36-22-8-12-24(13-9-22)43(2,41)42/h3-17H,34H2,1-2H3,(H,36,38) |
| InChIKey | ICVVYJJVWAIRAY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 120.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|