C26H25F2NO3 — CID 123975330
(2,6-difluorophenyl)-[4-[2-(methoxymethyl)-2,6-dimethylchromen-4-yl]anilino]methanol (PubChem CID 123975330) has the molecular formula C26H25F2NO3 and a molecular weight of 437.49 g/mol. Its IUPAC name is (2,6-difluorophenyl)-[4-[2-(methoxymethyl)-2,6-dimethylchromen-4-yl]anilino]methanol.
| Compound Name | (2,6-difluorophenyl)-[4-[2-(methoxymethyl)-2,6-dimethylchromen-4-yl]anilino]methanol |
|---|---|
| PubChem CID | 123975330 |
| Molecular Formula | C26H25F2NO3 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (2,6-difluorophenyl)-[4-[2-(methoxymethyl)-2,6-dimethylchromen-4-yl]anilino]methanol |
| SMILES | COCC1(C)C=C(c2ccc(NC(O)c3c(F)cccc3F)cc2)c2cc(C)ccc2O1 |
| InChI | InChI=1S/C26H25F2NO3/c1-16-7-12-23-19(13-16)20(14-26(2,32-23)15-31-3)17-8-10-18(11-9-17)29-25(30)24-21(27)5-4-6-22(24)28/h4-14,25,29-30H,15H2,1-3H3 |
| InChIKey | JVWNMXPYRJIEMT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|