About silyloxysilyl 2-methylbut-2-enoate
silyloxysilyl 2-methylbut-2-enoate (PubChem CID 123975924) has the molecular formula C5H12O3Si2
and a molecular weight of 176.32 g/mol. Its IUPAC name is silyloxysilyl 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | silyloxysilyl 2-methylbut-2-enoate |
| PubChem CID | 123975924 |
| Molecular Formula | C5H12O3Si2 |
| Molecular Weight | 176.32 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | silyloxysilyl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[SiH2]O[SiH3] |
| InChI | InChI=1S/C5H12O3Si2/c1-3-4(2)5(6)7-10-8-9/h3H,10H2,1-2,9H3 |
| InChIKey | BYZXUJIHPWDJMV-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.32 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze silyloxysilyl 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyloxysilyl 2-methylbut-2-enoate?
The IUPAC name of silyloxysilyl 2-methylbut-2-enoate (CID 123975924) is silyloxysilyl 2-methylbut-2-enoate.
What is the SMILES notation for silyloxysilyl 2-methylbut-2-enoate?
The canonical SMILES for silyloxysilyl 2-methylbut-2-enoate is CC=C(C)C(=O)O[SiH2]O[SiH3].
What is the InChIKey of silyloxysilyl 2-methylbut-2-enoate?
The InChIKey is BYZXUJIHPWDJMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O3Si2/c1-3-4(2)5(6)7-10-8-9/h3H,10H2,1-2,9H3.
What are the key properties of silyloxysilyl 2-methylbut-2-enoate?
silyloxysilyl 2-methylbut-2-enoate has a molecular weight of 176.32 g/mol, XLogP of -1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silyloxysilyl 2-methylbut-2-enoate is sourced from PubChem (CID 123975924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).