C21H28FN7O2S — CID 123977376
1-[4-[1-(amino-methyl-oxo-λ6-sulfanylidene)propan-2-yl]-6-[(3R)-3-methylmorpholin-4-yl]pyrimidin-2-yl]-4-fluoro-N-methylbenzimidazol-2-amine (PubChem CID 123977376) has the molecular formula C21H28FN7O2S and a molecular weight of 461.57 g/mol. Its IUPAC name is 1-[4-[1-(amino-methyl-oxo-λ6-sulfanylidene)propan-2-yl]-6-[(3R)-3-methylmorpholin-4-yl]pyrimidin-2-yl]-4-fluoro-N-methylbenzimidazol-2-amine.
| Compound Name | 1-[4-[1-(amino-methyl-oxo-λ6-sulfanylidene)propan-2-yl]-6-[(3R)-3-methylmorpholin-4-yl]pyrimidin-2-yl]-4-fluoro-N-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 123977376 |
| Molecular Formula | C21H28FN7O2S |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 1-[4-[1-(amino-methyl-oxo-λ6-sulfanylidene)propan-2-yl]-6-[(3R)-3-methylmorpholin-4-yl]pyrimidin-2-yl]-4-fluoro-N-methylbenzimidazol-2-amine |
| SMILES | CNc1nc2c(F)cccc2n1-c1nc(C(C)C=S(C)(N)=O)cc(N2CCOC[C@H]2C)n1 |
| InChI | InChI=1S/C21H28FN7O2S/c1-13(12-32(4,23)30)16-10-18(28-8-9-31-11-14(28)2)26-21(25-16)29-17-7-5-6-15(22)19(17)27-20(29)24-3/h5-7,10,12-14H,8-9,11H2,1-4H3,(H2,23,30)(H,24,27)/t13?,14-,32?/m1/s1 |
| InChIKey | DFFIEJXLGRRBEB-OVYCIKBLSA-N |
| XLogP | 1.91 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|