About 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol
6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol (PubChem CID 123977544) has the molecular formula C16H37NOS
and a molecular weight of 291.54 g/mol. Its IUPAC name is 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol.
Molecular Properties
| Compound Name | 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol |
| PubChem CID | 123977544 |
| Molecular Formula | C16H37NOS |
| Molecular Weight | 291.54 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol |
| SMILES | CC(C)(C)CNCCCCC(CO)CCS(C)(C)C |
| InChI | InChI=1S/C16H37NOS/c1-16(2,3)14-17-11-8-7-9-15(13-18)10-12-19(4,5)6/h15,17-18H,7-14H2,1-6H3 |
| InChIKey | BMWPYUTYEDMJCB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol?
The IUPAC name of 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol (CID 123977544) is 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol.
What is the SMILES notation for 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol?
The canonical SMILES for 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol is CC(C)(C)CNCCCCC(CO)CCS(C)(C)C.
What is the InChIKey of 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol?
The InChIKey is BMWPYUTYEDMJCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H37NOS/c1-16(2,3)14-17-11-8-7-9-15(13-18)10-12-19(4,5)6/h15,17-18H,7-14H2,1-6H3.
What are the key properties of 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol?
6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol has a molecular weight of 291.54 g/mol, XLogP of 3.48, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-dimethylpropylamino)-2-[2-(trimethyl-λ4-sulfanyl)ethyl]hexan-1-ol is sourced from PubChem (CID 123977544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).