C17H35N — CID 123978386
N-tert-butyl-2,4,4,6,6-pentamethyl-5-methylideneheptan-2-amine (PubChem CID 123978386) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is N-tert-butyl-2,4,4,6,6-pentamethyl-5-methylideneheptan-2-amine.
| Compound Name | N-tert-butyl-2,4,4,6,6-pentamethyl-5-methylideneheptan-2-amine |
|---|---|
| PubChem CID | 123978386 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | N-tert-butyl-2,4,4,6,6-pentamethyl-5-methylideneheptan-2-amine |
| SMILES | C=C(C(C)(C)C)C(C)(C)CC(C)(C)NC(C)(C)C |
| InChI | InChI=1S/C17H35N/c1-13(14(2,3)4)16(8,9)12-17(10,11)18-15(5,6)7/h18H,1,12H2,2-11H3 |
| InChIKey | PRHGKQFZOKZCSS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|