C41H45Cl2N7O2 — CID 123978598
6-chloro-4-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]-1-methylpiperidin-2-yl]-2-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine (PubChem CID 123978598) has the molecular formula C41H45Cl2N7O2 and a molecular weight of 738.76 g/mol. Its IUPAC name is 6-chloro-4-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]-1-methylpiperidin-2-yl]-2-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine.
| Compound Name | 6-chloro-4-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]-1-methylpiperidin-2-yl]-2-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine |
|---|---|
| PubChem CID | 123978598 |
| Molecular Formula | C41H45Cl2N7O2 |
| Molecular Weight | 738.76 g/mol |
| Exact Mass | 737.30 |
| IUPAC Name | 6-chloro-4-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]-1-methylpiperidin-2-yl]-2-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]acridin-9-amine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NC3CCN(C)C(c4cc(OC)cc5c(NCCN6CCN(C)CC6)c6ccc(Cl)cc6nc45)C3)c2c1 |
| InChI | InChI=1S/C41H45Cl2N7O2/c1-48-15-17-50(18-16-48)14-12-44-39-30-8-5-26(43)20-37(30)47-41-33(23-29(52-4)24-34(39)41)38-21-27(11-13-49(38)2)45-40-31-9-6-25(42)19-36(31)46-35-10-7-28(51-3)22-32(35)40/h5-10,19-20,22-24,27,38H,11-18,21H2,1-4H3,(H,44,47)(H,45,46) |
| InChIKey | XPIJQFHNESPGPJ-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 78.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.76 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|