C23H22ClN3O6S — CID 123978616
2-[(2-chlorophenyl)sulfonylcarbamoylamino]-N-(3,4-dihydroxyphenyl)-N-methyl-3-phenylpropanamide (PubChem CID 123978616) has the molecular formula C23H22ClN3O6S and a molecular weight of 503.96 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)sulfonylcarbamoylamino]-N-(3,4-dihydroxyphenyl)-N-methyl-3-phenylpropanamide.
| Compound Name | 2-[(2-chlorophenyl)sulfonylcarbamoylamino]-N-(3,4-dihydroxyphenyl)-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 123978616 |
| Molecular Formula | C23H22ClN3O6S |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 2-[(2-chlorophenyl)sulfonylcarbamoylamino]-N-(3,4-dihydroxyphenyl)-N-methyl-3-phenylpropanamide |
| SMILES | CN(C(=O)C(Cc1ccccc1)NC(=O)NS(=O)(=O)c1ccccc1Cl)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C23H22ClN3O6S/c1-27(16-11-12-19(28)20(29)14-16)22(30)18(13-15-7-3-2-4-8-15)25-23(31)26-34(32,33)21-10-6-5-9-17(21)24/h2-12,14,18,28-29H,13H2,1H3,(H2,25,26,31) |
| InChIKey | HOTNKKVPQWBUKP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|