C24H31N5O4S — CID 123978877
CID 123978877 (PubChem CID 123978877) has the molecular formula C24H31N5O4S and a molecular weight of 485.61 g/mol.
| Compound Name | CID 123978877 |
|---|---|
| PubChem CID | 123978877 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)CC[C@H]2N1C(=O)[C@@H]2C[C@H]1CN2C[C@H](C)C(=O)N1CCC[C@H]1C#N.N=S(=O)=O |
| InChI | InChI=1S/C24H30N4O2.HNO2S/c1-15-5-7-20-17(10-15)6-8-21(20)28-19-11-22(24(28)30)26(14-19)13-16(2)23(29)27-9-3-4-18(27)12-25;1-4(2)3/h5,7,10,16,18-19,21-22H,3-4,6,8-9,11,13-14H2,1-2H3;1H/t16-,18-,19-,21+,22-;/m0./s1 |
| InChIKey | WBGPMFZSTOTJLK-AQRQOSCVSA-N |
| XLogP | 2.05 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |