About CID 123978877
CID 123978877 (PubChem CID 123978877) has the molecular formula C24H31N5O4S
and a molecular weight of 485.61 g/mol.
Molecular Properties
| Compound Name | CID 123978877 |
| PubChem CID | 123978877 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)CC[C@H]2N1C(=O)[C@@H]2C[C@H]1CN2C[C@H](C)C(=O)N1CCC[C@H]1C#N.N=S(=O)=O |
| InChI | InChI=1S/C24H30N4O2.HNO2S/c1-15-5-7-20-17(10-15)6-8-21(20)28-19-11-22(24(28)30)26(14-19)13-16(2)23(29)27-9-3-4-18(27)12-25;1-4(2)3/h5,7,10,16,18-19,21-22H,3-4,6,8-9,11,13-14H2,1-2H3;1H/t16-,18-,19-,21+,22-;/m0./s1 |
| InChIKey | WBGPMFZSTOTJLK-AQRQOSCVSA-N |
| XLogP | 2.05 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 123978877 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123978877?
The IUPAC name of CID 123978877 (CID 123978877) is not available.
What is the SMILES notation for CID 123978877?
The canonical SMILES for CID 123978877 is Cc1ccc2c(c1)CC[C@H]2N1C(=O)[C@@H]2C[C@H]1CN2C[C@H](C)C(=O)N1CCC[C@H]1C#N.N=S(=O)=O.
What is the InChIKey of CID 123978877?
The InChIKey is WBGPMFZSTOTJLK-AQRQOSCVSA-N. The full InChI is InChI=1S/C24H30N4O2.HNO2S/c1-15-5-7-20-17(10-15)6-8-21(20)28-19-11-22(24(28)30)26(14-19)13-16(2)23(29)27-9-3-4-18(27)12-25;1-4(2)3/h5,7,10,16,18-19,21-22H,3-4,6,8-9,11,13-14H2,1-2H3;1H/t16-,18-,19-,21+,22-;/m0./s1.
What are the key properties of CID 123978877?
CID 123978877 has a molecular weight of 485.61 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123978877 is sourced from PubChem (CID 123978877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).