About 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one
5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 123978896) has the molecular formula C9H15NO2S
and a molecular weight of 201.29 g/mol. Its IUPAC name is 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one |
| PubChem CID | 123978896 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | CCCC(CC)c1sc(=O)[nH]c1O |
| InChI | InChI=1S/C9H15NO2S/c1-3-5-6(4-2)7-8(11)10-9(12)13-7/h6,11H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | QJYMXJVHSVQXLT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one?
The IUPAC name of 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one (CID 123978896) is 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one.
What is the SMILES notation for 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one?
The canonical SMILES for 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one is CCCC(CC)c1sc(=O)[nH]c1O.
What is the InChIKey of 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one?
The InChIKey is QJYMXJVHSVQXLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2S/c1-3-5-6(4-2)7-8(11)10-9(12)13-7/h6,11H,3-5H2,1-2H3,(H,10,12).
What are the key properties of 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one?
5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one has a molecular weight of 201.29 g/mol, XLogP of 2.44, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexan-3-yl-4-hydroxy-3H-1,3-thiazol-2-one is sourced from PubChem (CID 123978896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).