About N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide
N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide (PubChem CID 123979154) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide.
Molecular Properties
| Compound Name | N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide |
| PubChem CID | 123979154 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide |
| SMILES | C=CC(=O)/C=C\CNC(C)=O |
| InChI | InChI=1S/C8H11NO2/c1-3-8(11)5-4-6-9-7(2)10/h3-5H,1,6H2,2H3,(H,9,10)/b5-4- |
| InChIKey | SCQJNFVDUUHVKY-PLNGDYQASA-N |
| XLogP | 0.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide?
The IUPAC name of N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide (CID 123979154) is N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide.
What is the SMILES notation for N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide?
The canonical SMILES for N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide is C=CC(=O)/C=C\CNC(C)=O.
What is the InChIKey of N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide?
The InChIKey is SCQJNFVDUUHVKY-PLNGDYQASA-N. The full InChI is InChI=1S/C8H11NO2/c1-3-8(11)5-4-6-9-7(2)10/h3-5H,1,6H2,2H3,(H,9,10)/b5-4-.
What are the key properties of N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide?
N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide has a molecular weight of 153.18 g/mol, XLogP of 0.43, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z)-4-oxohexa-2,5-dienyl]acetamide is sourced from PubChem (CID 123979154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).