C10H12F3NO4S2 — CID 123979320
6-methyl-N-(trifluoromethylsulfonyl)octa-1,3,5,7-tetraene-3-sulfonamide (PubChem CID 123979320) has the molecular formula C10H12F3NO4S2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 6-methyl-N-(trifluoromethylsulfonyl)octa-1,3,5,7-tetraene-3-sulfonamide.
| Compound Name | 6-methyl-N-(trifluoromethylsulfonyl)octa-1,3,5,7-tetraene-3-sulfonamide |
|---|---|
| PubChem CID | 123979320 |
| Molecular Formula | C10H12F3NO4S2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 6-methyl-N-(trifluoromethylsulfonyl)octa-1,3,5,7-tetraene-3-sulfonamide |
| SMILES | C=CC(C)=CC=C(C=C)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO4S2/c1-4-8(3)6-7-9(5-2)19(15,16)14-20(17,18)10(11,12)13/h4-7,14H,1-2H2,3H3 |
| InChIKey | GRDYESNFHLWFMT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|