C17H19NOS2 — CID 123979592
5-hexyl-4-(nitrosomethyl)thieno[3,2-g][1]benzothiole (PubChem CID 123979592) has the molecular formula C17H19NOS2 and a molecular weight of 317.48 g/mol. Its IUPAC name is 5-hexyl-4-(nitrosomethyl)thieno[3,2-g][1]benzothiole.
| Compound Name | 5-hexyl-4-(nitrosomethyl)thieno[3,2-g][1]benzothiole |
|---|---|
| PubChem CID | 123979592 |
| Molecular Formula | C17H19NOS2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 5-hexyl-4-(nitrosomethyl)thieno[3,2-g][1]benzothiole |
| SMILES | CCCCCCc1c(CN=O)c2ccsc2c2sccc12 |
| InChI | InChI=1S/C17H19NOS2/c1-2-3-4-5-6-12-13-7-9-20-16(13)17-14(8-10-21-17)15(12)11-18-19/h7-10H,2-6,11H2,1H3 |
| InChIKey | ZWHOQWSKUNIVDZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|