C21H20FN4OS+ — CID 123979648
[4-[[3-(5-fluoro-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-methylideneoxidanium (PubChem CID 123979648) has the molecular formula C21H20FN4OS+ and a molecular weight of 395.48 g/mol. Its IUPAC name is [4-[[3-(5-fluoro-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-methylideneoxidanium.
| Compound Name | [4-[[3-(5-fluoro-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-methylideneoxidanium |
|---|---|
| PubChem CID | 123979648 |
| Molecular Formula | C21H20FN4OS+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [4-[[3-(5-fluoro-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-methylideneoxidanium |
| SMILES | C=[O+]C1CCC(Nc2ccc3ncc(-c4cc5cc(F)ccc5s4)n3n2)CC1 |
| InChI | InChI=1S/C21H20FN4OS/c1-27-16-5-3-15(4-6-16)24-20-8-9-21-23-12-17(26(21)25-20)19-11-13-10-14(22)2-7-18(13)28-19/h2,7-12,15-16H,1,3-6H2,(H,24,25)/q+1 |
| InChIKey | UETCVOSFQCQRPA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|