C10H13F3O — CID 123979817
7,7,7-trifluoro-4-methoxy-5,6-dimethylhepta-1,3,5-triene (PubChem CID 123979817) has the molecular formula C10H13F3O and a molecular weight of 206.21 g/mol. Its IUPAC name is 7,7,7-trifluoro-4-methoxy-5,6-dimethylhepta-1,3,5-triene.
| Compound Name | 7,7,7-trifluoro-4-methoxy-5,6-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 123979817 |
| Molecular Formula | C10H13F3O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 7,7,7-trifluoro-4-methoxy-5,6-dimethylhepta-1,3,5-triene |
| SMILES | C=CC=C(OC)C(C)=C(C)C(F)(F)F |
| InChI | InChI=1S/C10H13F3O/c1-5-6-9(14-4)7(2)8(3)10(11,12)13/h5-6H,1H2,2-4H3 |
| InChIKey | YATCBBQLACFSLX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|