C32H34F2O7S2 — CID 123979958
[2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroethyl] 6-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 123979958) has the molecular formula C32H34F2O7S2 and a molecular weight of 632.75 g/mol. Its IUPAC name is [2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroethyl] 6-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroethyl] 6-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 123979958 |
| Molecular Formula | C32H34F2O7S2 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | [2-[dihydroxy-oxo-(triphenyl-λ4-sulfanyl)-λ6-sulfanyl]-2,2-difluoroethyl] 6-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C=C(C)C(=O)OC1CC2CC(C(=O)OCC(F)(F)S(=O)(O)(O)S(c3ccccc3)(c3ccccc3)c3ccccc3)C1C2 |
| InChI | InChI=1S/C32H34F2O7S2/c1-22(2)30(35)41-29-20-23-18-27(29)28(19-23)31(36)40-21-32(33,34)43(37,38,39)42(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-17,23,27-29H,1,18-21H2,2H3,(H2,37,38,39) |
| InChIKey | LCYFNWWUUMCBBT-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|