C17H31F3N2O — CID 123980313
5-ethyl-4-nonan-3-yl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one (PubChem CID 123980313) has the molecular formula C17H31F3N2O and a molecular weight of 336.44 g/mol. Its IUPAC name is 5-ethyl-4-nonan-3-yl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one.
| Compound Name | 5-ethyl-4-nonan-3-yl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 123980313 |
| Molecular Formula | C17H31F3N2O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 5-ethyl-4-nonan-3-yl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one |
| SMILES | CCCCCCC(CC)C1NC(=O)N(CC(F)(F)F)CC1CC |
| InChI | InChI=1S/C17H31F3N2O/c1-4-7-8-9-10-13(5-2)15-14(6-3)11-22(16(23)21-15)12-17(18,19)20/h13-15H,4-12H2,1-3H3,(H,21,23) |
| InChIKey | HQOPSZQNYMEGIA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|