C6H12N+ — CID 123980388
1-ethenyl-1,2-dimethylaziridin-1-ium (PubChem CID 123980388) has the molecular formula C6H12N+ and a molecular weight of 98.17 g/mol. Its IUPAC name is 1-ethenyl-1,2-dimethylaziridin-1-ium.
| Compound Name | 1-ethenyl-1,2-dimethylaziridin-1-ium |
|---|---|
| PubChem CID | 123980388 |
| Molecular Formula | C6H12N+ |
| Molecular Weight | 98.17 g/mol |
| Exact Mass | 98.10 |
| IUPAC Name | 1-ethenyl-1,2-dimethylaziridin-1-ium |
| SMILES | C=C[N+]1(C)CC1C |
| InChI | InChI=1S/C6H12N/c1-4-7(3)5-6(7)2/h4,6H,1,5H2,2-3H3/q+1 |
| InChIKey | MPOXLSIOAXDOPQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|