C23H26O6 — CID 123980464
8-hydroxy-15-(4-hydroxy-3-methylbut-2-enyl)-17,17-dimethyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8-triene-10,14-dione (PubChem CID 123980464) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 8-hydroxy-15-(4-hydroxy-3-methylbut-2-enyl)-17,17-dimethyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8-triene-10,14-dione.
| Compound Name | 8-hydroxy-15-(4-hydroxy-3-methylbut-2-enyl)-17,17-dimethyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8-triene-10,14-dione |
|---|---|
| PubChem CID | 123980464 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 8-hydroxy-15-(4-hydroxy-3-methylbut-2-enyl)-17,17-dimethyl-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8-triene-10,14-dione |
| SMILES | CC(=CCC12OC(C)(C)C3CC(CC4C(=O)c5c(O)cccc5OC431)C2=O)CO |
| InChI | InChI=1S/C23H26O6/c1-12(11-24)7-8-22-20(27)13-9-14-19(26)18-15(25)5-4-6-16(18)28-23(14,22)17(10-13)21(2,3)29-22/h4-7,13-14,17,24-25H,8-11H2,1-3H3 |
| InChIKey | CMXYZEPHQJQIMJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|