C20H22F3N3O2S2 — CID 123980550
2-[3-prop-1-ynyl-4-[4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]piperazin-1-yl]sulfonyl-1,3-thiazole (PubChem CID 123980550) has the molecular formula C20H22F3N3O2S2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 2-[3-prop-1-ynyl-4-[4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]piperazin-1-yl]sulfonyl-1,3-thiazole.
| Compound Name | 2-[3-prop-1-ynyl-4-[4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]piperazin-1-yl]sulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 123980550 |
| Molecular Formula | C20H22F3N3O2S2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-[3-prop-1-ynyl-4-[4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]piperazin-1-yl]sulfonyl-1,3-thiazole |
| SMILES | CC#CC1CN(S(=O)(=O)c2nccs2)CCN1c1ccc(C(C)(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3N3O2S2/c1-4-5-17-14-25(30(27,28)18-24-10-13-29-18)11-12-26(17)16-8-6-15(7-9-16)19(2,3)20(21,22)23/h6-10,13,17H,11-12,14H2,1-3H3 |
| InChIKey | SNAJEZGGGSJYIT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|