C11H20OS — CID 123980832
1-ethoxy-2,3,4-trimethyl-1λ4-thiacyclohepta-5,7-diene (PubChem CID 123980832) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is 1-ethoxy-2,3,4-trimethyl-1λ4-thiacyclohepta-5,7-diene.
| Compound Name | 1-ethoxy-2,3,4-trimethyl-1λ4-thiacyclohepta-5,7-diene |
|---|---|
| PubChem CID | 123980832 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-ethoxy-2,3,4-trimethyl-1λ4-thiacyclohepta-5,7-diene |
| SMILES | CCOS1=CC=CC(C)C(C)C1C |
| InChI | InChI=1S/C11H20OS/c1-5-12-13-8-6-7-9(2)10(3)11(13)4/h6-11H,5H2,1-4H3 |
| InChIKey | ANBTXWJZDFJVIE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|