About 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine
2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine (PubChem CID 123981516) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine.
Molecular Properties
| Compound Name | 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine |
| PubChem CID | 123981516 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine |
| SMILES | [H]/N=C/C(/C=N/C)C1=CCCN=C1 |
| InChI | InChI=1S/C9H13N3/c1-11-6-9(5-10)8-3-2-4-12-7-8/h3,5-7,9-10H,2,4H2,1H3/b10-5+,11-6+ |
| InChIKey | DADPEISFIITFBV-YOYBCKCWSA-N |
| XLogP | 1.35 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine?
The IUPAC name of 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine (CID 123981516) is 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine.
What is the SMILES notation for 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine?
The canonical SMILES for 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine is [H]/N=C/C(/C=N/C)C1=CCCN=C1.
What is the InChIKey of 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine?
The InChIKey is DADPEISFIITFBV-YOYBCKCWSA-N. The full InChI is InChI=1S/C9H13N3/c1-11-6-9(5-10)8-3-2-4-12-7-8/h3,5-7,9-10H,2,4H2,1H3/b10-5+,11-6+.
What are the key properties of 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine?
2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine has a molecular weight of 163.22 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydropyridin-5-yl)-N'-methylpropane-1,3-diimine is sourced from PubChem (CID 123981516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).