About tetrasulfanyl(3,3,3-triethoxypropyl)silane
tetrasulfanyl(3,3,3-triethoxypropyl)silane (PubChem CID 123981868) has the molecular formula C9H22O3S4Si
and a molecular weight of 334.63 g/mol. Its IUPAC name is tetrasulfanyl(3,3,3-triethoxypropyl)silane.
Molecular Properties
| Compound Name | tetrasulfanyl(3,3,3-triethoxypropyl)silane |
| PubChem CID | 123981868 |
| Molecular Formula | C9H22O3S4Si |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | tetrasulfanyl(3,3,3-triethoxypropyl)silane |
| SMILES | CCOC(CC[SiH2]SSSS)(OCC)OCC |
| InChI | InChI=1S/C9H22O3S4Si/c1-4-10-9(11-5-2,12-6-3)7-8-17-16-15-14-13/h13H,4-8,17H2,1-3H3 |
| InChIKey | DIJKCEVFUWKUEA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tetrasulfanyl(3,3,3-triethoxypropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrasulfanyl(3,3,3-triethoxypropyl)silane?
The IUPAC name of tetrasulfanyl(3,3,3-triethoxypropyl)silane (CID 123981868) is tetrasulfanyl(3,3,3-triethoxypropyl)silane.
What is the SMILES notation for tetrasulfanyl(3,3,3-triethoxypropyl)silane?
The canonical SMILES for tetrasulfanyl(3,3,3-triethoxypropyl)silane is CCOC(CC[SiH2]SSSS)(OCC)OCC.
What is the InChIKey of tetrasulfanyl(3,3,3-triethoxypropyl)silane?
The InChIKey is DIJKCEVFUWKUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22O3S4Si/c1-4-10-9(11-5-2,12-6-3)7-8-17-16-15-14-13/h13H,4-8,17H2,1-3H3.
What are the key properties of tetrasulfanyl(3,3,3-triethoxypropyl)silane?
tetrasulfanyl(3,3,3-triethoxypropyl)silane has a molecular weight of 334.63 g/mol, XLogP of 3.52, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tetrasulfanyl(3,3,3-triethoxypropyl)silane is sourced from PubChem (CID 123981868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).