C12H14F2N3O+ — CID 123982246
3-(difluoromethoxy)-5-(1-propan-2-ylazet-1-ium-2-yl)pyridin-2-amine (PubChem CID 123982246) has the molecular formula C12H14F2N3O+ and a molecular weight of 254.26 g/mol. Its IUPAC name is 3-(difluoromethoxy)-5-(1-propan-2-ylazet-1-ium-2-yl)pyridin-2-amine.
| Compound Name | 3-(difluoromethoxy)-5-(1-propan-2-ylazet-1-ium-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 123982246 |
| Molecular Formula | C12H14F2N3O+ |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-(difluoromethoxy)-5-(1-propan-2-ylazet-1-ium-2-yl)pyridin-2-amine |
| SMILES | CC(C)[N+]1=C(c2cnc(N)c(OC(F)F)c2)C=C1 |
| InChI | InChI=1S/C12H13F2N3O/c1-7(2)17-4-3-9(17)8-5-10(18-12(13)14)11(15)16-6-8/h3-7,12,15H,1-2H3/p+1 |
| InChIKey | VHFFLFGMCPVFLU-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 51.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|