C30H50O4 — CID 123982849
15-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2,6,11,12-tetramethylpentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,17-diol (PubChem CID 123982849) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is 15-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2,6,11,12-tetramethylpentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,17-diol.
| Compound Name | 15-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2,6,11,12-tetramethylpentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,17-diol |
|---|---|
| PubChem CID | 123982849 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | 15-[5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2,6,11,12-tetramethylpentacyclo[9.7.0.02,8.06,8.012,16]octadecane-5,17-diol |
| SMILES | CC(C)(O)C1CCC(C)(C2CCC3(C)C2C(O)CC2C3(C)CCC34CC3(C)C(O)CCC24C)O1 |
| InChI | InChI=1S/C30H50O4/c1-24(2,33)22-10-13-29(7,34-22)18-8-11-27(5)23(18)19(31)16-20-25(27,3)14-15-30-17-28(30,6)21(32)9-12-26(20,30)4/h18-23,31-33H,8-17H2,1-7H3 |
| InChIKey | PTKSSOAQDIVUEN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |