C11H16F3N — CID 123982899
1,3-dimethyl-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydroindole (PubChem CID 123982899) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is 1,3-dimethyl-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydroindole.
| Compound Name | 1,3-dimethyl-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 123982899 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 1,3-dimethyl-5-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydroindole |
| SMILES | CC1=CN(C)C2CCC(C(F)(F)F)CC12 |
| InChI | InChI=1S/C11H16F3N/c1-7-6-15(2)10-4-3-8(5-9(7)10)11(12,13)14/h6,8-10H,3-5H2,1-2H3 |
| InChIKey | LIJGEFNSGRWXJC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |