C31H52O9Si — CID 123983314
4,6-dihydroxy-5,12-bis(methoxymethyl)-15-(2-methoxy-1-triethylsilyloxyethyl)-16,18-dimethyl-2,14-dioxatetracyclo[9.7.0.01,7.03,8]octadeca-9,17-dien-13-one (PubChem CID 123983314) has the molecular formula C31H52O9Si and a molecular weight of 596.83 g/mol. Its IUPAC name is 4,6-dihydroxy-5,12-bis(methoxymethyl)-15-(2-methoxy-1-triethylsilyloxyethyl)-16,18-dimethyl-2,14-dioxatetracyclo[9.7.0.01,7.03,8]octadeca-9,17-dien-13-one.
| Compound Name | 4,6-dihydroxy-5,12-bis(methoxymethyl)-15-(2-methoxy-1-triethylsilyloxyethyl)-16,18-dimethyl-2,14-dioxatetracyclo[9.7.0.01,7.03,8]octadeca-9,17-dien-13-one |
|---|---|
| PubChem CID | 123983314 |
| Molecular Formula | C31H52O9Si |
| Molecular Weight | 596.83 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | 4,6-dihydroxy-5,12-bis(methoxymethyl)-15-(2-methoxy-1-triethylsilyloxyethyl)-16,18-dimethyl-2,14-dioxatetracyclo[9.7.0.01,7.03,8]octadeca-9,17-dien-13-one |
| SMILES | CC[Si](CC)(CC)OC(COC)C1OC(=O)C(COC)C2C=CC3C4OC2(C(C)=CC1C)C3C(O)C(COC)C4O |
| InChI | InChI=1S/C31H52O9Si/c1-9-41(10-2,11-3)40-24(17-37-8)28-18(4)14-19(5)31-23(21(15-35-6)30(34)38-28)13-12-20-25(31)26(32)22(16-36-7)27(33)29(20)39-31/h12-14,18,20-29,32-33H,9-11,15-17H2,1-8H3 |
| InChIKey | CRLXUFILRXFADZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.83 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|