About (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone
(1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone (PubChem CID 123983373) has the molecular formula C15H25N5O
and a molecular weight of 291.40 g/mol. Its IUPAC name is (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone |
| PubChem CID | 123983373 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone |
| SMILES | CCC=C(C)n1cnc(C(=O)N2CCNC(CCC)C2)n1 |
| InChI | InChI=1S/C15H25N5O/c1-4-6-12(3)20-11-17-14(18-20)15(21)19-9-8-16-13(10-19)7-5-2/h6,11,13,16H,4-5,7-10H2,1-3H3 |
| InChIKey | SNWBYSGPPLBAEW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone?
The IUPAC name of (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone (CID 123983373) is (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone.
What is the SMILES notation for (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone?
The canonical SMILES for (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone is CCC=C(C)n1cnc(C(=O)N2CCNC(CCC)C2)n1.
What is the InChIKey of (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone?
The InChIKey is SNWBYSGPPLBAEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5O/c1-4-6-12(3)20-11-17-14(18-20)15(21)19-9-8-16-13(10-19)7-5-2/h6,11,13,16H,4-5,7-10H2,1-3H3.
What are the key properties of (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone?
(1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone has a molecular weight of 291.40 g/mol, XLogP of 1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-pent-2-en-2-yl-1,2,4-triazol-3-yl)-(3-propylpiperazin-1-yl)methanone is sourced from PubChem (CID 123983373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).