C14H20N4O+2 — CID 123983432
N-cyclobutyl-7-methoxy-2,4-dimethyl-1,2,4-benzotriazine-2,4-diium-3-amine (PubChem CID 123983432) has the molecular formula C14H20N4O+2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-cyclobutyl-7-methoxy-2,4-dimethyl-1,2,4-benzotriazine-2,4-diium-3-amine.
| Compound Name | N-cyclobutyl-7-methoxy-2,4-dimethyl-1,2,4-benzotriazine-2,4-diium-3-amine |
|---|---|
| PubChem CID | 123983432 |
| Molecular Formula | C14H20N4O+2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-cyclobutyl-7-methoxy-2,4-dimethyl-1,2,4-benzotriazine-2,4-diium-3-amine |
| SMILES | COc1ccc2c(c1)n[n+](C)c(NC1CCC1)[n+]2C |
| InChI | InChI=1S/C14H19N4O/c1-17-13-8-7-11(19-3)9-12(13)16-18(2)14(17)15-10-5-4-6-10/h7-10H,4-6H2,1-3H3/q+1/p+1 |
| InChIKey | FUTDONIAXNLIPU-UHFFFAOYSA-O |
| XLogP | 0.86 |
| TPSA | 41.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|