C18H35NO — CID 123983479
2-tert-butyl-1-(hepta-4,6-dien-3-ylamino)-4,4-dimethylpentan-1-ol (PubChem CID 123983479) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is 2-tert-butyl-1-(hepta-4,6-dien-3-ylamino)-4,4-dimethylpentan-1-ol.
| Compound Name | 2-tert-butyl-1-(hepta-4,6-dien-3-ylamino)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 123983479 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 2-tert-butyl-1-(hepta-4,6-dien-3-ylamino)-4,4-dimethylpentan-1-ol |
| SMILES | C=CC=CC(CC)NC(O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H35NO/c1-9-11-12-14(10-2)19-16(20)15(18(6,7)8)13-17(3,4)5/h9,11-12,14-16,19-20H,1,10,13H2,2-8H3 |
| InChIKey | KTUNAIWUVNVRLQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|