C10H7BrF3NO2 — CID 123983613
(5R)-3-bromo-5-[4-(trifluoromethoxy)phenyl]-2,5-dihydro-1,2-oxazole (PubChem CID 123983613) has the molecular formula C10H7BrF3NO2 and a molecular weight of 310.07 g/mol. Its IUPAC name is (5R)-3-bromo-5-[4-(trifluoromethoxy)phenyl]-2,5-dihydro-1,2-oxazole.
| Compound Name | (5R)-3-bromo-5-[4-(trifluoromethoxy)phenyl]-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 123983613 |
| Molecular Formula | C10H7BrF3NO2 |
| Molecular Weight | 310.07 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | (5R)-3-bromo-5-[4-(trifluoromethoxy)phenyl]-2,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)Oc1ccc([C@H]2C=C(Br)NO2)cc1 |
| InChI | InChI=1S/C10H7BrF3NO2/c11-9-5-8(17-15-9)6-1-3-7(4-2-6)16-10(12,13)14/h1-5,8,15H/t8-/m1/s1 |
| InChIKey | ITXLVLGDYSIAAJ-MRVPVSSYSA-N |
| XLogP | 3.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.07 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|