C21H27N6O5+ — CID 123983896
5-amino-N-[(1R)-1-[3-[2-[2-(2-methoxyethoxy)ethyl]-1H-pyrazol-2-ium-4-yl]phenyl]ethyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 123983896) has the molecular formula C21H27N6O5+ and a molecular weight of 443.48 g/mol. Its IUPAC name is 5-amino-N-[(1R)-1-[3-[2-[2-(2-methoxyethoxy)ethyl]-1H-pyrazol-2-ium-4-yl]phenyl]ethyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | 5-amino-N-[(1R)-1-[3-[2-[2-(2-methoxyethoxy)ethyl]-1H-pyrazol-2-ium-4-yl]phenyl]ethyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 123983896 |
| Molecular Formula | C21H27N6O5+ |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 5-amino-N-[(1R)-1-[3-[2-[2-(2-methoxyethoxy)ethyl]-1H-pyrazol-2-ium-4-yl]phenyl]ethyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | COCCOCC[n+]1cc(-c2cccc([C@@H](C)NC(=O)c3[nH]c(=O)[nH]c(=O)c3N)c2)c[nH]1 |
| InChI | InChI=1S/C21H26N6O5/c1-13(24-20(29)18-17(22)19(28)26-21(30)25-18)14-4-3-5-15(10-14)16-11-23-27(12-16)6-7-32-9-8-31-2/h3-5,10-13H,6-9H2,1-2H3,(H5,22,24,25,26,28,29,30)/p+1/t13-/m1/s1 |
| InChIKey | WHTAEDHPHYXWAT-CYBMUJFWSA-O |
| XLogP | 0.08 |
| TPSA | 158.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|