About 2-methoxy-1-nitro-2,3-dihydroindole
2-methoxy-1-nitro-2,3-dihydroindole (PubChem CID 123983927) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-methoxy-1-nitro-2,3-dihydroindole.
Molecular Properties
| Compound Name | 2-methoxy-1-nitro-2,3-dihydroindole |
| PubChem CID | 123983927 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-methoxy-1-nitro-2,3-dihydroindole |
| SMILES | COC1Cc2ccccc2N1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N2O3/c1-14-9-6-7-4-2-3-5-8(7)10(9)11(12)13/h2-5,9H,6H2,1H3 |
| InChIKey | YKMIQSILEMWYKY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-1-nitro-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-nitro-2,3-dihydroindole?
The IUPAC name of 2-methoxy-1-nitro-2,3-dihydroindole (CID 123983927) is 2-methoxy-1-nitro-2,3-dihydroindole.
What is the SMILES notation for 2-methoxy-1-nitro-2,3-dihydroindole?
The canonical SMILES for 2-methoxy-1-nitro-2,3-dihydroindole is COC1Cc2ccccc2N1[N+](=O)[O-].
What is the InChIKey of 2-methoxy-1-nitro-2,3-dihydroindole?
The InChIKey is YKMIQSILEMWYKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c1-14-9-6-7-4-2-3-5-8(7)10(9)11(12)13/h2-5,9H,6H2,1H3.
What are the key properties of 2-methoxy-1-nitro-2,3-dihydroindole?
2-methoxy-1-nitro-2,3-dihydroindole has a molecular weight of 194.19 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-nitro-2,3-dihydroindole is sourced from PubChem (CID 123983927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).