C25H21F2N5O2 — CID 123984300
2-[2-[[2-fluoro-6-(2-fluoro-4-pyridinyl)-4-methyl-3-pyridinyl]oxy]-5-pyridin-3-ylphenyl]ethyl carbamimidate (PubChem CID 123984300) has the molecular formula C25H21F2N5O2 and a molecular weight of 461.47 g/mol. Its IUPAC name is 2-[2-[[2-fluoro-6-(2-fluoro-4-pyridinyl)-4-methyl-3-pyridinyl]oxy]-5-pyridin-3-ylphenyl]ethyl carbamimidate.
| Compound Name | 2-[2-[[2-fluoro-6-(2-fluoro-4-pyridinyl)-4-methyl-3-pyridinyl]oxy]-5-pyridin-3-ylphenyl]ethyl carbamimidate |
|---|---|
| PubChem CID | 123984300 |
| Molecular Formula | C25H21F2N5O2 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-[2-[[2-fluoro-6-(2-fluoro-4-pyridinyl)-4-methyl-3-pyridinyl]oxy]-5-pyridin-3-ylphenyl]ethyl carbamimidate |
| SMILES | [H]/N=C(\N)OCCc1cc(-c2cccnc2)ccc1Oc1c(C)cc(-c2ccnc(F)c2)nc1F |
| InChI | InChI=1S/C25H21F2N5O2/c1-15-11-20(17-6-9-31-22(26)13-17)32-24(27)23(15)34-21-5-4-16(19-3-2-8-30-14-19)12-18(21)7-10-33-25(28)29/h2-6,8-9,11-14H,7,10H2,1H3,(H3,28,29) |
| InChIKey | DUXUOIWAIUDFMG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|